C14H20O4S — CID 162457023
4-(benzenesulfonylmethyl)-2-tert-butyl-1,3-dioxolane (PubChem CID 162457023) has the molecular formula C14H20O4S and a molecular weight of 284.38 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-2-tert-butyl-1,3-dioxolane.
| Compound Name | 4-(benzenesulfonylmethyl)-2-tert-butyl-1,3-dioxolane |
|---|---|
| PubChem CID | 162457023 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-2-tert-butyl-1,3-dioxolane |
| SMILES | CC(C)(C)C1OCC(CS(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C14H20O4S/c1-14(2,3)13-17-9-11(18-13)10-19(15,16)12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3 |
| InChIKey | PNFYKWHEKQLIFU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |