C9H8F2O3S — CID 115474689
2-[(3,4-difluorophenyl)sulfonylmethyl]oxirane (PubChem CID 115474689) has the molecular formula C9H8F2O3S and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)sulfonylmethyl]oxirane.
| Compound Name | 2-[(3,4-difluorophenyl)sulfonylmethyl]oxirane |
|---|---|
| PubChem CID | 115474689 |
| Molecular Formula | C9H8F2O3S |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 2-[(3,4-difluorophenyl)sulfonylmethyl]oxirane |
| SMILES | O=S(=O)(CC1CO1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H8F2O3S/c10-8-2-1-7(3-9(8)11)15(12,13)5-6-4-14-6/h1-3,6H,4-5H2 |
| InChIKey | FJJHKQDXCLJAHV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|