C8H8F2O3S — CID 111104635
2-(3,4-difluorophenyl)sulfonylethanol (PubChem CID 111104635) has the molecular formula C8H8F2O3S and a molecular weight of 222.21 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfonylethanol.
| Compound Name | 2-(3,4-difluorophenyl)sulfonylethanol |
|---|---|
| PubChem CID | 111104635 |
| Molecular Formula | C8H8F2O3S |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfonylethanol |
| SMILES | O=S(=O)(CCO)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H8F2O3S/c9-7-2-1-6(5-8(7)10)14(12,13)4-3-11/h1-2,5,11H,3-4H2 |
| InChIKey | DQUGKRYWGGMHOW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |