C10H13F2NO3S — CID 54879245
N-ethyl-3,4-difluoro-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 54879245) has the molecular formula C10H13F2NO3S and a molecular weight of 265.28 g/mol. Its IUPAC name is N-ethyl-3,4-difluoro-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | N-ethyl-3,4-difluoro-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54879245 |
| Molecular Formula | C10H13F2NO3S |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-ethyl-3,4-difluoro-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | CCN(CCO)S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H13F2NO3S/c1-2-13(5-6-14)17(15,16)8-3-4-9(11)10(12)7-8/h3-4,7,14H,2,5-6H2,1H3 |
| InChIKey | SFLRKOOXTZPZOE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |