C10H13FN2O5S — CID 54878677
N-ethyl-2-fluoro-N-(2-hydroxyethyl)-5-nitrobenzenesulfonamide (PubChem CID 54878677) has the molecular formula C10H13FN2O5S and a molecular weight of 292.29 g/mol. Its IUPAC name is N-ethyl-2-fluoro-N-(2-hydroxyethyl)-5-nitrobenzenesulfonamide.
| Compound Name | N-ethyl-2-fluoro-N-(2-hydroxyethyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 54878677 |
| Molecular Formula | C10H13FN2O5S |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | N-ethyl-2-fluoro-N-(2-hydroxyethyl)-5-nitrobenzenesulfonamide |
| SMILES | CCN(CCO)S(=O)(=O)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C10H13FN2O5S/c1-2-12(5-6-14)19(17,18)10-7-8(13(15)16)3-4-9(10)11/h3-4,7,14H,2,5-6H2,1H3 |
| InChIKey | DKVBOZFBLYNJPH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|