C10H15N3O6S — CID 62147107
2-amino-N,N-bis(2-hydroxyethyl)-4-nitrobenzenesulfonamide (PubChem CID 62147107) has the molecular formula C10H15N3O6S and a molecular weight of 305.31 g/mol. Its IUPAC name is 2-amino-N,N-bis(2-hydroxyethyl)-4-nitrobenzenesulfonamide.
| Compound Name | 2-amino-N,N-bis(2-hydroxyethyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62147107 |
| Molecular Formula | C10H15N3O6S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-amino-N,N-bis(2-hydroxyethyl)-4-nitrobenzenesulfonamide |
| SMILES | Nc1cc([N+](=O)[O-])ccc1S(=O)(=O)N(CCO)CCO |
| InChI | InChI=1S/C10H15N3O6S/c11-9-7-8(13(16)17)1-2-10(9)20(18,19)12(3-5-14)4-6-15/h1-2,7,14-15H,3-6,11H2 |
| InChIKey | OIDJYZWZMMKXFX-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|