C16H17ClN4O7S — CID 4022644
4-chloro-N-[2-(2,4-dinitroanilino)ethyl]-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 4022644) has the molecular formula C16H17ClN4O7S and a molecular weight of 444.85 g/mol. Its IUPAC name is 4-chloro-N-[2-(2,4-dinitroanilino)ethyl]-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-(2,4-dinitroanilino)ethyl]-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4022644 |
| Molecular Formula | C16H17ClN4O7S |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 4-chloro-N-[2-(2,4-dinitroanilino)ethyl]-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(NCCN(CCO)S(=O)(=O)c2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H17ClN4O7S/c17-12-1-4-14(5-2-12)29(27,28)19(9-10-22)8-7-18-15-6-3-13(20(23)24)11-16(15)21(25)26/h1-6,11,18,22H,7-10H2 |
| InChIKey | FEHPJFJOZWXINS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|