C21H28N4O4S — CID 20620092
2-[4-[4-[2-(benzenesulfonamido)-3-oxobutyl]phenoxy]butyl]guanidine (PubChem CID 20620092) has the molecular formula C21H28N4O4S and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-[4-[4-[2-(benzenesulfonamido)-3-oxobutyl]phenoxy]butyl]guanidine.
| Compound Name | 2-[4-[4-[2-(benzenesulfonamido)-3-oxobutyl]phenoxy]butyl]guanidine |
|---|---|
| PubChem CID | 20620092 |
| Molecular Formula | C21H28N4O4S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2-[4-[4-[2-(benzenesulfonamido)-3-oxobutyl]phenoxy]butyl]guanidine |
| SMILES | CC(=O)C(Cc1ccc(OCCCCN=C(N)N)cc1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H28N4O4S/c1-16(26)20(25-30(27,28)19-7-3-2-4-8-19)15-17-9-11-18(12-10-17)29-14-6-5-13-24-21(22)23/h2-4,7-12,20,25H,5-6,13-15H2,1H3,(H4,22,23,24) |
| InChIKey | STIKJUSCUSZVJD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|