C19H23ClN4O6S — CID 18322476
2-[(3-chlorophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid (PubChem CID 18322476) has the molecular formula C19H23ClN4O6S and a molecular weight of 470.94 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid.
| Compound Name | 2-[(3-chlorophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 18322476 |
| Molecular Formula | C19H23ClN4O6S |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 2-[(3-chlorophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
| SMILES | NC(N)=NOCCCOc1ccc(CC(NS(=O)(=O)c2cccc(Cl)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H23ClN4O6S/c20-14-3-1-4-16(12-14)31(27,28)24-17(18(25)26)11-13-5-7-15(8-6-13)29-9-2-10-30-23-19(21)22/h1,3-8,12,17,24H,2,9-11H2,(H,25,26)(H4,21,22,23) |
| InChIKey | DRUVKBHBKAEGOZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|