C21H28N4O6S — CID 57258256
(2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,5-dimethylphenyl)sulfonylamino]propanoic acid (PubChem CID 57258256) has the molecular formula C21H28N4O6S and a molecular weight of 464.54 g/mol. Its IUPAC name is (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,5-dimethylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,5-dimethylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 57258256 |
| Molecular Formula | C21H28N4O6S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,5-dimethylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N[C@@H](Cc2ccc(OCCCON=C(N)N)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C21H28N4O6S/c1-14-4-5-15(2)19(12-14)32(28,29)25-18(20(26)27)13-16-6-8-17(9-7-16)30-10-3-11-31-24-21(22)23/h4-9,12,18,25H,3,10-11,13H2,1-2H3,(H,26,27)(H4,22,23,24)/t18-/m0/s1 |
| InChIKey | QPGOCSZLZCHTBS-SFHVURJKSA-N |
| XLogP | 1.25 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|