C21H27LiN4O6S — CID 142012442
lithium carbamimidoyl-[3-[4-[(2S)-2-carboxy-2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]phenoxy]propoxy]azanide (PubChem CID 142012442) has the molecular formula C21H27LiN4O6S and a molecular weight of 470.48 g/mol. Its IUPAC name is lithium carbamimidoyl-[3-[4-[(2S)-2-carboxy-2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]phenoxy]propoxy]azanide.
| Compound Name | lithium carbamimidoyl-[3-[4-[(2S)-2-carboxy-2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]phenoxy]propoxy]azanide |
|---|---|
| PubChem CID | 142012442 |
| Molecular Formula | C21H27LiN4O6S |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | lithium carbamimidoyl-[3-[4-[(2S)-2-carboxy-2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]phenoxy]propoxy]azanide |
| SMILES | [H]/N=C(\N)[N-]OCCCOc1ccc(C[C@H](NS(=O)(=O)c2cc(C)ccc2C)C(=O)O)cc1.[Li+] |
| InChI | InChI=1S/C21H28N4O6S.Li/c1-14-4-5-15(2)19(12-14)32(28,29)25-18(20(26)27)13-16-6-8-17(9-7-16)30-10-3-11-31-24-21(22)23;/h4-9,12,18,25H,3,10-11,13H2,1-2H3,(H5,22,23,24,26,27);/q;+1/p-1/t18-;/m0./s1 |
| InChIKey | ZGYALDPYTXPENQ-FERBBOLQSA-M |
| XLogP | -0.75 |
| TPSA | 165.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|