C21H26BrClN4O6S — CID 22946565
2-[(4-bromo-2-chloro-6-ethylphenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid (PubChem CID 22946565) has the molecular formula C21H26BrClN4O6S and a molecular weight of 577.89 g/mol. Its IUPAC name is 2-[(4-bromo-2-chloro-6-ethylphenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid.
| Compound Name | 2-[(4-bromo-2-chloro-6-ethylphenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22946565 |
| Molecular Formula | C21H26BrClN4O6S |
| Molecular Weight | 577.89 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | 2-[(4-bromo-2-chloro-6-ethylphenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
| SMILES | CCc1cc(Br)cc(Cl)c1S(=O)(=O)NC(Cc1ccc(OCCCON=C(N)N)cc1)C(=O)O |
| InChI | InChI=1S/C21H26BrClN4O6S/c1-2-14-11-15(22)12-17(23)19(14)34(30,31)27-18(20(28)29)10-13-4-6-16(7-5-13)32-8-3-9-33-26-21(24)25/h4-7,11-12,18,27H,2-3,8-10H2,1H3,(H,28,29)(H4,24,25,26) |
| InChIKey | ULERCCROTMSQRX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.89 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|