C17H19BrCl2N4O6S2 — CID 18322529
2-[(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid (PubChem CID 18322529) has the molecular formula C17H19BrCl2N4O6S2 and a molecular weight of 590.30 g/mol. Its IUPAC name is 2-[(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid.
| Compound Name | 2-[(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 18322529 |
| Molecular Formula | C17H19BrCl2N4O6S2 |
| Molecular Weight | 590.30 g/mol |
| Exact Mass | 587.93 |
| IUPAC Name | 2-[(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
| SMILES | NC(N)=NOCCCOc1ccc(CC(NS(=O)(=O)c2c(Cl)sc(Cl)c2Br)C(=O)O)cc1 |
| InChI | InChI=1S/C17H19BrCl2N4O6S2/c18-12-13(15(20)31-14(12)19)32(27,28)24-11(16(25)26)8-9-2-4-10(5-3-9)29-6-1-7-30-23-17(21)22/h2-5,11,24H,1,6-8H2,(H,25,26)(H4,21,22,23) |
| InChIKey | KRKQKAFCKBRQIA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|