C20H26N4O6S — CID 59873661
(2S)-2-(benzylsulfonylamino)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid (PubChem CID 59873661) has the molecular formula C20H26N4O6S and a molecular weight of 450.52 g/mol. Its IUPAC name is (2S)-2-(benzylsulfonylamino)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(benzylsulfonylamino)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 59873661 |
| Molecular Formula | C20H26N4O6S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (2S)-2-(benzylsulfonylamino)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
| SMILES | NC(N)=NOCCCOc1ccc(C[C@H](NS(=O)(=O)Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H26N4O6S/c21-20(22)23-30-12-4-11-29-17-9-7-15(8-10-17)13-18(19(25)26)24-31(27,28)14-16-5-2-1-3-6-16/h1-3,5-10,18,24H,4,11-14H2,(H,25,26)(H4,21,22,23)/t18-/m0/s1 |
| InChIKey | UQKZBEGHFWRHRH-SFHVURJKSA-N |
| XLogP | 0.78 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|