C22H24F3N5O10S — CID 139931510
(2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2-nitrophenyl)methylsulfonylamino]propaneperoxoate (PubChem CID 139931510) has the molecular formula C22H24F3N5O10S and a molecular weight of 607.52 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2-nitrophenyl)methylsulfonylamino]propaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2-nitrophenyl)methylsulfonylamino]propaneperoxoate |
|---|---|
| PubChem CID | 139931510 |
| Molecular Formula | C22H24F3N5O10S |
| Molecular Weight | 607.52 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2-nitrophenyl)methylsulfonylamino]propaneperoxoate |
| SMILES | NC(N)=NOCCCOc1ccc(C[C@H](NS(=O)(=O)Cc2ccccc2[N+](=O)[O-])C(=O)OOC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H24F3N5O10S/c23-22(24,25)20(32)40-39-19(31)17(29-41(35,36)13-15-4-1-2-5-18(15)30(33)34)12-14-6-8-16(9-7-14)37-10-3-11-38-28-21(26)27/h1-2,4-9,17,29H,3,10-13H2,(H4,26,27,28)/t17-/m0/s1 |
| InChIKey | OOXVJNYWHUSWPG-KRWDZBQOSA-N |
| XLogP | 1.16 |
| TPSA | 224.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.52 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|