C19H23BrN4O6S — CID 18322523
2-[(2-bromophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid (PubChem CID 18322523) has the molecular formula C19H23BrN4O6S and a molecular weight of 515.39 g/mol. Its IUPAC name is 2-[(2-bromophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid.
| Compound Name | 2-[(2-bromophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 18322523 |
| Molecular Formula | C19H23BrN4O6S |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | 2-[(2-bromophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
| SMILES | NC(N)=NOCCCOc1ccc(CC(NS(=O)(=O)c2ccccc2Br)C(=O)O)cc1 |
| InChI | InChI=1S/C19H23BrN4O6S/c20-15-4-1-2-5-17(15)31(27,28)24-16(18(25)26)12-13-6-8-14(9-7-13)29-10-3-11-30-23-19(21)22/h1-2,4-9,16,24H,3,10-12H2,(H,25,26)(H4,21,22,23) |
| InChIKey | ZBIWNLMZUZDODW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|