C20H25ClN4O7S — CID 18322448
2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid (PubChem CID 18322448) has the molecular formula C20H25ClN4O7S and a molecular weight of 500.96 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid.
| Compound Name | 2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 18322448 |
| Molecular Formula | C20H25ClN4O7S |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NC(Cc1ccc(OCCCON=C(N)N)cc1)C(=O)O |
| InChI | InChI=1S/C20H25ClN4O7S/c1-30-17-8-5-14(21)12-18(17)33(28,29)25-16(19(26)27)11-13-3-6-15(7-4-13)31-9-2-10-32-24-20(22)23/h3-8,12,16,25H,2,9-11H2,1H3,(H,26,27)(H4,22,23,24) |
| InChIKey | PWMCRPLEYFAJPI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 175.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|