C19H22Cl2N4O6S — CID 18322491
3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,5-dichlorophenyl)sulfonylamino]propanoic acid (PubChem CID 18322491) has the molecular formula C19H22Cl2N4O6S and a molecular weight of 505.38 g/mol. Its IUPAC name is 3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,5-dichlorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,5-dichlorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 18322491 |
| Molecular Formula | C19H22Cl2N4O6S |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,5-dichlorophenyl)sulfonylamino]propanoic acid |
| SMILES | NC(N)=NOCCCOc1ccc(CC(NS(=O)(=O)c2cc(Cl)ccc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C19H22Cl2N4O6S/c20-13-4-7-15(21)17(11-13)32(28,29)25-16(18(26)27)10-12-2-5-14(6-3-12)30-8-1-9-31-24-19(22)23/h2-7,11,16,25H,1,8-10H2,(H,26,27)(H4,22,23,24) |
| InChIKey | LNQJKKLEUAGDHI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|