C22H22F6N4O8S — CID 139931459
(2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propaneperoxoate (PubChem CID 139931459) has the molecular formula C22H22F6N4O8S and a molecular weight of 616.49 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propaneperoxoate |
|---|---|
| PubChem CID | 139931459 |
| Molecular Formula | C22H22F6N4O8S |
| Molecular Weight | 616.49 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propaneperoxoate |
| SMILES | NC(N)=NOCCCOc1ccc(C[C@H](NS(=O)(=O)c2ccccc2C(F)(F)F)C(=O)OOC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F6N4O8S/c23-21(24,25)15-4-1-2-5-17(15)41(35,36)32-16(18(33)39-40-19(34)22(26,27)28)12-13-6-8-14(9-7-13)37-10-3-11-38-31-20(29)30/h1-2,4-9,16,32H,3,10-12H2,(H4,29,30,31)/t16-/m0/s1 |
| InChIKey | JQXDVJQASQSDSA-INIZCTEOSA-N |
| XLogP | 2.13 |
| TPSA | 181.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|