C24H29F3N4O8S — CID 139931503
(2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propaneperoxoate (PubChem CID 139931503) has the molecular formula C24H29F3N4O8S and a molecular weight of 590.58 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propaneperoxoate |
|---|---|
| PubChem CID | 139931503 |
| Molecular Formula | C24H29F3N4O8S |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propaneperoxoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@@H](Cc2ccc(OCCCON=C(N)N)cc2)C(=O)OOC(=O)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C24H29F3N4O8S/c1-14-11-15(2)20(16(3)12-14)40(34,35)31-19(21(32)38-39-22(33)24(25,26)27)13-17-5-7-18(8-6-17)36-9-4-10-37-30-23(28)29/h5-8,11-12,19,31H,4,9-10,13H2,1-3H3,(H4,28,29,30)/t19-/m0/s1 |
| InChIKey | YLBMMGQWDHSOKG-IBGZPJMESA-N |
| XLogP | 2.04 |
| TPSA | 181.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|