C21H22F3IN4O8S — CID 139931527
(2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(4-iodophenyl)sulfonylamino]propaneperoxoate (PubChem CID 139931527) has the molecular formula C21H22F3IN4O8S and a molecular weight of 674.39 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(4-iodophenyl)sulfonylamino]propaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(4-iodophenyl)sulfonylamino]propaneperoxoate |
|---|---|
| PubChem CID | 139931527 |
| Molecular Formula | C21H22F3IN4O8S |
| Molecular Weight | 674.39 g/mol |
| Exact Mass | 674.02 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(4-iodophenyl)sulfonylamino]propaneperoxoate |
| SMILES | NC(N)=NOCCCOc1ccc(C[C@H](NS(=O)(=O)c2ccc(I)cc2)C(=O)OOC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3IN4O8S/c22-21(23,24)19(31)37-36-18(30)17(29-38(32,33)16-8-4-14(25)5-9-16)12-13-2-6-15(7-3-13)34-10-1-11-35-28-20(26)27/h2-9,17,29H,1,10-12H2,(H4,26,27,28)/t17-/m0/s1 |
| InChIKey | XVPQGSVULGBQJG-KRWDZBQOSA-N |
| XLogP | 1.72 |
| TPSA | 181.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|