C29H37F3N4O9S — CID 139931523
(2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]propaneperoxoate (PubChem CID 139931523) has the molecular formula C29H37F3N4O9S and a molecular weight of 674.70 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]propaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]propaneperoxoate |
|---|---|
| PubChem CID | 139931523 |
| Molecular Formula | C29H37F3N4O9S |
| Molecular Weight | 674.70 g/mol |
| Exact Mass | 674.22 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]propaneperoxoate |
| SMILES | Cc1c(C)c(S(=O)(=O)N[C@@H](Cc2ccc(OCCCON=C(N)N)cc2)C(=O)OOC(=O)C(F)(F)F)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C29H37F3N4O9S/c1-16-17(2)24(18(3)21-11-12-28(4,5)43-23(16)21)46(39,40)36-22(25(37)44-45-26(38)29(30,31)32)15-19-7-9-20(10-8-19)41-13-6-14-42-35-27(33)34/h7-10,22,36H,6,11-15H2,1-5H3,(H4,33,34,35)/t22-/m0/s1 |
| InChIKey | PGYPHRYRCNBBII-QFIPXVFZSA-N |
| XLogP | 3.14 |
| TPSA | 190.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.70 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|