C16H19F3O5S — CID 150792042
(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl 2,2,2-trifluoroacetate (PubChem CID 150792042) has the molecular formula C16H19F3O5S and a molecular weight of 380.38 g/mol. Its IUPAC name is (2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl 2,2,2-trifluoroacetate.
| Compound Name | (2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 150792042 |
| Molecular Formula | C16H19F3O5S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl 2,2,2-trifluoroacetate |
| SMILES | Cc1c(C)c(S(=O)(=O)OC(=O)C(F)(F)F)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C16H19F3O5S/c1-8-9(2)13(25(21,22)24-14(20)16(17,18)19)10(3)11-6-7-15(4,5)23-12(8)11/h6-7H2,1-5H3 |
| InChIKey | KEBBBSYZHVXZIX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|