C22H33NO3S — CID 11003689
(2R,3S)-2-ethenyl-3-(2-methylpropyl)-1-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]aziridine (PubChem CID 11003689) has the molecular formula C22H33NO3S and a molecular weight of 391.58 g/mol. Its IUPAC name is (2R,3S)-2-ethenyl-3-(2-methylpropyl)-1-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]aziridine.
| Compound Name | (2R,3S)-2-ethenyl-3-(2-methylpropyl)-1-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]aziridine |
|---|---|
| PubChem CID | 11003689 |
| Molecular Formula | C22H33NO3S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | (2R,3S)-2-ethenyl-3-(2-methylpropyl)-1-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]aziridine |
| SMILES | C=C[C@@H]1[C@H](CC(C)C)N1S(=O)(=O)c1c(C)c(C)c2c(c1C)CCC(C)(C)O2 |
| InChI | InChI=1S/C22H33NO3S/c1-9-18-19(12-13(2)3)23(18)27(24,25)21-15(5)14(4)20-17(16(21)6)10-11-22(7,8)26-20/h9,13,18-19H,1,10-12H2,2-8H3/t18-,19+,23?/m1/s1 |
| InChIKey | ZSTWEIDZBUSPEP-BEWYTNLXSA-N |
| XLogP | 4.69 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|