C27H43NO5S — CID 10648869
(E,2R,5S)-7-methyl-2-(2-methylpropyl)-5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]oct-3-enoic acid (PubChem CID 10648869) has the molecular formula C27H43NO5S and a molecular weight of 493.71 g/mol. Its IUPAC name is (E,2R,5S)-7-methyl-2-(2-methylpropyl)-5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]oct-3-enoic acid.
| Compound Name | (E,2R,5S)-7-methyl-2-(2-methylpropyl)-5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]oct-3-enoic acid |
|---|---|
| PubChem CID | 10648869 |
| Molecular Formula | C27H43NO5S |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | (E,2R,5S)-7-methyl-2-(2-methylpropyl)-5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]oct-3-enoic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)N[C@H](/C=C/C(CC(C)C)C(=O)O)CC(C)C)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C27H43NO5S/c1-16(2)14-21(26(29)30)10-11-22(15-17(3)4)28-34(31,32)25-19(6)18(5)24-23(20(25)7)12-13-27(8,9)33-24/h10-11,16-17,21-22,28H,12-15H2,1-9H3,(H,29,30)/b11-10+/t21?,22-/m1/s1 |
| InChIKey | YDWWEGFOCOPMMJ-JNIQBVEHSA-N |
| XLogP | 5.71 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|