C26H41N5O6S — CID 58560398
methyl (2S)-2-[[(2R)-2-amino-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]pentanoyl]amino]pent-4-enoate (PubChem CID 58560398) has the molecular formula C26H41N5O6S and a molecular weight of 551.71 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-amino-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]pentanoyl]amino]pent-4-enoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-amino-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]pentanoyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 58560398 |
| Molecular Formula | C26H41N5O6S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-amino-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]pentanoyl]amino]pent-4-enoate |
| SMILES | C=CC[C@H](NC(=O)[C@H](N)CCC/N=C(\N)NS(=O)(=O)c1c(C)c(C)c2c(c1C)CCC(C)(C)O2)C(=O)OC |
| InChI | InChI=1S/C26H41N5O6S/c1-8-10-20(24(33)36-7)30-23(32)19(27)11-9-14-29-25(28)31-38(34,35)22-16(3)15(2)21-18(17(22)4)12-13-26(5,6)37-21/h8,19-20H,1,9-14,27H2,2-7H3,(H,30,32)(H3,28,29,31)/t19-,20+/m1/s1 |
| InChIKey | AUKGDNGXSXJYGX-UXHICEINSA-N |
| XLogP | 1.65 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|