C32H47N5O6S — CID 69486412
tert-butyl N-[(2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-1-(4-methylanilino)-1-oxopentan-2-yl]carbamate (PubChem CID 69486412) has the molecular formula C32H47N5O6S and a molecular weight of 629.82 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-1-(4-methylanilino)-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-1-(4-methylanilino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 69486412 |
| Molecular Formula | C32H47N5O6S |
| Molecular Weight | 629.82 g/mol |
| Exact Mass | 629.32 |
| IUPAC Name | tert-butyl N-[(2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-1-(4-methylanilino)-1-oxopentan-2-yl]carbamate |
| SMILES | Cc1ccc(NC(=O)[C@H](CCC/N=C(\N)NS(=O)(=O)c2c(C)c(C)c3c(c2C)CCC(C)(C)O3)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C32H47N5O6S/c1-19-12-14-23(15-13-19)35-28(38)25(36-30(39)43-31(5,6)7)11-10-18-34-29(33)37-44(40,41)27-21(3)20(2)26-24(22(27)4)16-17-32(8,9)42-26/h12-15,25H,10-11,16-18H2,1-9H3,(H,35,38)(H,36,39)(H3,33,34,37)/t25-/m0/s1 |
| InChIKey | NAZXINKDGFIZQG-VWLOTQADSA-N |
| XLogP | 4.93 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.82 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|