C27H38N4O5S — CID 122577394
(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-N-[4-(hydroxymethyl)phenyl]-2-methylpentanamide (PubChem CID 122577394) has the molecular formula C27H38N4O5S and a molecular weight of 530.69 g/mol. Its IUPAC name is (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-N-[4-(hydroxymethyl)phenyl]-2-methylpentanamide.
| Compound Name | (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-N-[4-(hydroxymethyl)phenyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 122577394 |
| Molecular Formula | C27H38N4O5S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-N-[4-(hydroxymethyl)phenyl]-2-methylpentanamide |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](C)C(=O)Nc2ccc(CO)cc2)c(C)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C27H38N4O5S/c1-16(25(33)30-21-11-9-20(15-32)10-12-21)8-7-13-29-26(28)31-37(34,35)24-18(3)17(2)23-22(19(24)4)14-27(5,6)36-23/h9-12,16,32H,7-8,13-15H2,1-6H3,(H,30,33)(H3,28,29,31)/t16-/m0/s1 |
| InChIKey | YAZIHDGIMQWDPY-INIZCTEOSA-N |
| XLogP | 3.47 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|