C31H43N5O9S — CID 175879964
(2S)-2-[[(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[methyl(phenylmethoxycarbonyl)amino]pentanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 175879964) has the molecular formula C31H43N5O9S and a molecular weight of 661.78 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[methyl(phenylmethoxycarbonyl)amino]pentanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[methyl(phenylmethoxycarbonyl)amino]pentanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 175879964 |
| Molecular Formula | C31H43N5O9S |
| Molecular Weight | 661.78 g/mol |
| Exact Mass | 661.28 |
| IUPAC Name | (2S)-2-[[(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[methyl(phenylmethoxycarbonyl)amino]pentanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCC[C@@H](C(=O)N[C@@H](CO)C(=O)O)N(C)C(=O)OCc2ccccc2)c(C)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C31H43N5O9S/c1-18-19(2)26(20(3)22-15-31(4,5)45-25(18)22)46(42,43)35-29(32)33-14-10-13-24(27(38)34-23(16-37)28(39)40)36(6)30(41)44-17-21-11-8-7-9-12-21/h7-9,11-12,23-24,37H,10,13-17H2,1-6H3,(H,34,38)(H,39,40)(H3,32,33,35)/t23-,24-/m0/s1 |
| InChIKey | GAJDCGXFJFDRFB-ZEQRLZLVSA-N |
| XLogP | 1.90 |
| TPSA | 209.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.78 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|