C25H42N4O4S — CID 59270207
2-[6-methyl-5-oxo-4-(propan-2-ylamino)heptyl]-1-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonyl]guanidine (PubChem CID 59270207) has the molecular formula C25H42N4O4S and a molecular weight of 494.70 g/mol. Its IUPAC name is 2-[6-methyl-5-oxo-4-(propan-2-ylamino)heptyl]-1-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonyl]guanidine.
| Compound Name | 2-[6-methyl-5-oxo-4-(propan-2-ylamino)heptyl]-1-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonyl]guanidine |
|---|---|
| PubChem CID | 59270207 |
| Molecular Formula | C25H42N4O4S |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 2-[6-methyl-5-oxo-4-(propan-2-ylamino)heptyl]-1-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonyl]guanidine |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCCC(NC(C)C)C(=O)C(C)C)c(C)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C25H42N4O4S/c1-14(2)21(30)20(28-15(3)4)11-10-12-27-24(26)29-34(31,32)23-17(6)16(5)22-19(18(23)7)13-25(8,9)33-22/h14-15,20,28H,10-13H2,1-9H3,(H3,26,27,29) |
| InChIKey | CXZHTEPVWIWBAR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|