C29H46N6O8S — CID 142766143
4-[(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]piperazine-1-carboxylic acid (PubChem CID 142766143) has the molecular formula C29H46N6O8S and a molecular weight of 638.79 g/mol. Its IUPAC name is 4-[(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 142766143 |
| Molecular Formula | C29H46N6O8S |
| Molecular Weight | 638.79 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | 4-[(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]piperazine-1-carboxylic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)OC(C)(C)C)C(=O)N2CCN(C(=O)O)CC2)c(C)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C29H46N6O8S/c1-17-18(2)23(19(3)20-16-29(7,8)42-22(17)20)44(40,41)33-25(30)31-11-9-10-21(32-26(37)43-28(4,5)6)24(36)34-12-14-35(15-13-34)27(38)39/h21H,9-16H2,1-8H3,(H,32,37)(H,38,39)(H3,30,31,33)/t21-/m0/s1 |
| InChIKey | PBALDVVWKTUJCE-NRFANRHFSA-N |
| XLogP | 2.41 |
| TPSA | 192.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.79 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|