C20H32N4O5S — CID 59105869
(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(methylamino)pentanoic acid (PubChem CID 59105869) has the molecular formula C20H32N4O5S and a molecular weight of 440.57 g/mol. Its IUPAC name is (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(methylamino)pentanoic acid.
| Compound Name | (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 59105869 |
| Molecular Formula | C20H32N4O5S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(methylamino)pentanoic acid |
| SMILES | CN[C@@H](CCC/N=C(\N)NS(=O)(=O)c1c(C)c(C)c2c(c1C)CC(C)(C)O2)C(=O)O |
| InChI | InChI=1S/C20H32N4O5S/c1-11-12(2)17(13(3)14-10-20(4,5)29-16(11)14)30(27,28)24-19(21)23-9-7-8-15(22-6)18(25)26/h15,22H,7-10H2,1-6H3,(H,25,26)(H3,21,23,24)/t15-/m0/s1 |
| InChIKey | NYCSUKXJKPTYOU-HNNXBMFYSA-N |
| XLogP | 1.37 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|