C25H40N6O6S — CID 91260905
5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(4-methylpiperazine-1-carbonyl)amino]pentanoic acid (PubChem CID 91260905) has the molecular formula C25H40N6O6S and a molecular weight of 552.70 g/mol. Its IUPAC name is 5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(4-methylpiperazine-1-carbonyl)amino]pentanoic acid.
| Compound Name | 5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(4-methylpiperazine-1-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 91260905 |
| Molecular Formula | C25H40N6O6S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(4-methylpiperazine-1-carbonyl)amino]pentanoic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCCC(NC(=O)N2CCN(C)CC2)C(=O)O)c(C)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C25H40N6O6S/c1-15-16(2)21(17(3)18-14-25(4,5)37-20(15)18)38(35,36)29-23(26)27-9-7-8-19(22(32)33)28-24(34)31-12-10-30(6)11-13-31/h19H,7-14H2,1-6H3,(H,28,34)(H,32,33)(H3,26,27,29) |
| InChIKey | IKTJIBWTAMVEMA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 166.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|