C24H40ClN5O5S — CID 164539434
[(3S)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-hydroxy-1-[(1-methylcyclopropyl)amino]-1-oxohexan-3-yl]azanium chloride (PubChem CID 164539434) has the molecular formula C24H40ClN5O5S and a molecular weight of 546.13 g/mol. Its IUPAC name is [(3S)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-hydroxy-1-[(1-methylcyclopropyl)amino]-1-oxohexan-3-yl]azanium chloride.
| Compound Name | [(3S)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-hydroxy-1-[(1-methylcyclopropyl)amino]-1-oxohexan-3-yl]azanium chloride |
|---|---|
| PubChem CID | 164539434 |
| Molecular Formula | C24H40ClN5O5S |
| Molecular Weight | 546.13 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | [(3S)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-hydroxy-1-[(1-methylcyclopropyl)amino]-1-oxohexan-3-yl]azanium chloride |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H]([NH3+])C(O)C(=O)NC2(C)CC2)c(C)c2c1OC(C)(C)C2.[Cl-] |
| InChI | InChI=1S/C24H39N5O5S.ClH/c1-13-14(2)20(15(3)16-12-23(4,5)34-19(13)16)35(32,33)29-22(26)27-11-7-8-17(25)18(30)21(31)28-24(6)9-10-24;/h17-18,30H,7-12,25H2,1-6H3,(H,28,31)(H3,26,27,29);1H/t17-,18?;/m0./s1 |
| InChIKey | LGNYTWKONJCCIF-OQICONIUSA-N |
| XLogP | -2.66 |
| TPSA | 170.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.13 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|