C25H41N5O6S — CID 11249691
tert-butyl 2-[[(2S)-2-amino-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]pentanoyl]amino]acetate (PubChem CID 11249691) has the molecular formula C25H41N5O6S and a molecular weight of 539.70 g/mol. Its IUPAC name is tert-butyl 2-[[(2S)-2-amino-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]pentanoyl]amino]acetate.
| Compound Name | tert-butyl 2-[[(2S)-2-amino-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]pentanoyl]amino]acetate |
|---|---|
| PubChem CID | 11249691 |
| Molecular Formula | C25H41N5O6S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | tert-butyl 2-[[(2S)-2-amino-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]pentanoyl]amino]acetate |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](N)C(=O)NCC(=O)OC(C)(C)C)c(C)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C25H41N5O6S/c1-14-15(2)21(16(3)17-12-25(7,8)36-20(14)17)37(33,34)30-23(27)28-11-9-10-18(26)22(32)29-13-19(31)35-24(4,5)6/h18H,9-13,26H2,1-8H3,(H,29,32)(H3,27,28,30)/t18-/m0/s1 |
| InChIKey | SBIKFOZARQCNNF-SFHVURJKSA-N |
| XLogP | 1.48 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|