C25H39N7O4S — CID 56991723
2-amino-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-N-[2-(1H-imidazol-2-yl)ethyl]pentanamide (PubChem CID 56991723) has the molecular formula C25H39N7O4S and a molecular weight of 533.70 g/mol. Its IUPAC name is 2-amino-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-N-[2-(1H-imidazol-2-yl)ethyl]pentanamide.
| Compound Name | 2-amino-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-N-[2-(1H-imidazol-2-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 56991723 |
| Molecular Formula | C25H39N7O4S |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 2-amino-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-N-[2-(1H-imidazol-2-yl)ethyl]pentanamide |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCCC(N)C(=O)NCCc2ncc[nH]2)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C25H39N7O4S/c1-15-16(2)22(17(3)18-8-10-25(4,5)36-21(15)18)37(34,35)32-24(27)31-11-6-7-19(26)23(33)30-12-9-20-28-13-14-29-20/h13-14,19H,6-12,26H2,1-5H3,(H,28,29)(H,30,33)(H3,27,31,32) |
| InChIKey | MJXLQMRAGMQROL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 177.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|