C33H41N5O7S — CID 69044542
(2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[(5-benzyl-6-oxo-1H-pyridine-3-carbonyl)amino]pentanoic acid (PubChem CID 69044542) has the molecular formula C33H41N5O7S and a molecular weight of 651.79 g/mol. Its IUPAC name is (2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[(5-benzyl-6-oxo-1H-pyridine-3-carbonyl)amino]pentanoic acid.
| Compound Name | (2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[(5-benzyl-6-oxo-1H-pyridine-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 69044542 |
| Molecular Formula | C33H41N5O7S |
| Molecular Weight | 651.79 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | (2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[(5-benzyl-6-oxo-1H-pyridine-3-carbonyl)amino]pentanoic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)c2c[nH]c(=O)c(Cc3ccccc3)c2)C(=O)O)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C33H41N5O7S/c1-19-20(2)28(21(3)25-13-14-33(4,5)45-27(19)25)46(43,44)38-32(34)35-15-9-12-26(31(41)42)37-30(40)24-17-23(29(39)36-18-24)16-22-10-7-6-8-11-22/h6-8,10-11,17-18,26H,9,12-16H2,1-5H3,(H,36,39)(H,37,40)(H,41,42)(H3,34,35,38)/t26-/m0/s1 |
| InChIKey | DZSRJZUHJIYZAK-SANMLTNESA-N |
| XLogP | 3.25 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.79 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|