C39H43N5O7S — CID 69039048
(2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[6-(9H-fluoren-9-yl)-2-oxo-1H-pyridine-3-carbonyl]amino]pentanoic acid (PubChem CID 69039048) has the molecular formula C39H43N5O7S and a molecular weight of 725.87 g/mol. Its IUPAC name is (2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[6-(9H-fluoren-9-yl)-2-oxo-1H-pyridine-3-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[6-(9H-fluoren-9-yl)-2-oxo-1H-pyridine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 69039048 |
| Molecular Formula | C39H43N5O7S |
| Molecular Weight | 725.87 g/mol |
| Exact Mass | 725.29 |
| IUPAC Name | (2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[6-(9H-fluoren-9-yl)-2-oxo-1H-pyridine-3-carbonyl]amino]pentanoic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)c2ccc(C3c4ccccc4-c4ccccc43)[nH]c2=O)C(=O)O)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C39H43N5O7S/c1-21-22(2)34(23(3)24-18-19-39(4,5)51-33(21)24)52(49,50)44-38(40)41-20-10-15-31(37(47)48)43-36(46)29-16-17-30(42-35(29)45)32-27-13-8-6-11-25(27)26-12-7-9-14-28(26)32/h6-9,11-14,16-17,31-32H,10,15,18-20H2,1-5H3,(H,42,45)(H,43,46)(H,47,48)(H3,40,41,44)/t31-/m0/s1 |
| InChIKey | IGAHMERVRBMLNI-HKBQPEDESA-N |
| XLogP | 4.82 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.87 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|