C32H46N4O7S — CID 131721787
tert-butyl (2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 131721787) has the molecular formula C32H46N4O7S and a molecular weight of 630.81 g/mol. Its IUPAC name is tert-butyl (2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | tert-butyl (2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 131721787 |
| Molecular Formula | C32H46N4O7S |
| Molecular Weight | 630.81 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | tert-butyl (2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)OCc2ccccc2)C(=O)OC(C)(C)C)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C32H46N4O7S/c1-20-21(2)27(22(3)24-16-17-32(7,8)42-26(20)24)44(39,40)36-29(33)34-18-12-15-25(28(37)43-31(4,5)6)35-30(38)41-19-23-13-10-9-11-14-23/h9-11,13-14,25H,12,15-19H2,1-8H3,(H,35,38)(H3,33,34,36)/t25-/m0/s1 |
| InChIKey | QKGRTKHUGWZNND-VWLOTQADSA-N |
| XLogP | 4.73 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.81 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|