C37H45N5O8S — CID 101454109
2-[[(2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]acetic acid (PubChem CID 101454109) has the molecular formula C37H45N5O8S and a molecular weight of 719.86 g/mol. Its IUPAC name is 2-[[(2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 101454109 |
| Molecular Formula | C37H45N5O8S |
| Molecular Weight | 719.86 g/mol |
| Exact Mass | 719.30 |
| IUPAC Name | 2-[[(2S)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]acetic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)NCC(=O)O)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C37H45N5O8S/c1-21-22(2)33(23(3)24-16-17-37(4,5)50-32(21)24)51(47,48)42-35(38)39-18-10-15-30(34(45)40-19-31(43)44)41-36(46)49-20-29-27-13-8-6-11-25(27)26-12-7-9-14-28(26)29/h6-9,11-14,29-30H,10,15-20H2,1-5H3,(H,40,45)(H,41,46)(H,43,44)(H3,38,39,42)/t30-/m0/s1 |
| InChIKey | ZZYKJFGPTUSMQN-PMERELPUSA-N |
| XLogP | 4.20 |
| TPSA | 198.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|