C37H46N4O7S — CID 86622252
methyl (3S)-6-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate (PubChem CID 86622252) has the molecular formula C37H46N4O7S and a molecular weight of 690.86 g/mol. Its IUPAC name is methyl (3S)-6-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (3S)-6-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 86622252 |
| Molecular Formula | C37H46N4O7S |
| Molecular Weight | 690.86 g/mol |
| Exact Mass | 690.31 |
| IUPAC Name | methyl (3S)-6-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)C[C@H](CCC/N=C(\N)NS(=O)(=O)c1c(C)c(C)c2c(c1C)CCC(C)(C)O2)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H46N4O7S/c1-22-23(2)34(24(3)26-17-18-37(4,5)48-33(22)26)49(44,45)41-35(38)39-19-11-12-25(20-32(42)46-6)40-36(43)47-21-31-29-15-9-7-13-27(29)28-14-8-10-16-30(28)31/h7-10,13-16,25,31H,11-12,17-21H2,1-6H3,(H,40,43)(H3,38,39,41)/t25-/m0/s1 |
| InChIKey | AWWSDPCCEBGXPS-VWLOTQADSA-N |
| XLogP | 5.56 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.86 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|