C24H40N4O6S — CID 118222255
2-amino-6-[[[(2-methylpropan-2-yl)oxyamino]-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]hexanoic acid (PubChem CID 118222255) has the molecular formula C24H40N4O6S and a molecular weight of 512.67 g/mol. Its IUPAC name is 2-amino-6-[[[(2-methylpropan-2-yl)oxyamino]-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]hexanoic acid.
| Compound Name | 2-amino-6-[[[(2-methylpropan-2-yl)oxyamino]-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]hexanoic acid |
|---|---|
| PubChem CID | 118222255 |
| Molecular Formula | C24H40N4O6S |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 2-amino-6-[[[(2-methylpropan-2-yl)oxyamino]-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]hexanoic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(=N/CCCCC(N)C(=O)O)NOC(C)(C)C)c(C)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C24H40N4O6S/c1-14-15(2)20(16(3)17-13-24(7,8)33-19(14)17)35(31,32)28-22(27-34-23(4,5)6)26-12-10-9-11-18(25)21(29)30/h18H,9-13,25H2,1-8H3,(H,29,30)(H2,26,27,28) |
| InChIKey | ICJYGHWINTUZPO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 152.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|