C32H46N4O7S2 — CID 175954967
2-[(4S)-5-oxo-5-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonyl]-4-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]pentyl]guanidine (PubChem CID 175954967) has the molecular formula C32H46N4O7S2 and a molecular weight of 662.88 g/mol. Its IUPAC name is 2-[(4S)-5-oxo-5-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonyl]-4-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]pentyl]guanidine.
| Compound Name | 2-[(4S)-5-oxo-5-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonyl]-4-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]pentyl]guanidine |
|---|---|
| PubChem CID | 175954967 |
| Molecular Formula | C32H46N4O7S2 |
| Molecular Weight | 662.88 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | 2-[(4S)-5-oxo-5-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonyl]-4-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]pentyl]guanidine |
| SMILES | Cc1c(C)c(S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)S(=O)(=O)c2c(C)c(C)c3c(c2C)CC(C)(C)O3)c(C)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C32H46N4O7S2/c1-16-18(3)27(20(5)22-14-31(7,8)42-25(16)22)44(38,39)29(37)24(12-11-13-35-30(33)34)36-45(40,41)28-19(4)17(2)26-23(21(28)6)15-32(9,10)43-26/h24,36H,11-15H2,1-10H3,(H4,33,34,35)/t24-/m0/s1 |
| InChIKey | ABOFXPIXAXVICE-DEOSSOPVSA-N |
| XLogP | 3.67 |
| TPSA | 180.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.88 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|