C25H40N6O5S2 — CID 11671376
tert-butyl N-[(5S)-5-azido-6-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylcarbamothioylamino]hexyl]carbamate (PubChem CID 11671376) has the molecular formula C25H40N6O5S2 and a molecular weight of 568.77 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-azido-6-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylcarbamothioylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-azido-6-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylcarbamothioylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 11671376 |
| Molecular Formula | C25H40N6O5S2 |
| Molecular Weight | 568.77 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | tert-butyl N-[(5S)-5-azido-6-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylcarbamothioylamino]hexyl]carbamate |
| SMILES | Cc1c(C)c(S(=O)(=O)NC(=S)NC[C@H](CCCCNC(=O)OC(C)(C)C)N=[N+]=[N-])c(C)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C25H40N6O5S2/c1-15-16(2)21(17(3)19-13-25(7,8)35-20(15)19)38(33,34)30-22(37)28-14-18(29-31-26)11-9-10-12-27-23(32)36-24(4,5)6/h18H,9-14H2,1-8H3,(H,27,32)(H2,28,30,37)/t18-/m0/s1 |
| InChIKey | JMRIEIVFFHLFRL-SFHVURJKSA-N |
| XLogP | 4.85 |
| TPSA | 154.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|