C17H28O4S — CID 143895265
ethane;methyl 2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonate (PubChem CID 143895265) has the molecular formula C17H28O4S and a molecular weight of 328.47 g/mol. Its IUPAC name is ethane;methyl 2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonate.
| Compound Name | ethane;methyl 2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonate |
|---|---|
| PubChem CID | 143895265 |
| Molecular Formula | C17H28O4S |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | ethane;methyl 2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonate |
| SMILES | CC.COS(=O)(=O)c1c(C)c(C)c2c(c1C)CCC(C)(C)O2 |
| InChI | InChI=1S/C15H22O4S.C2H6/c1-9-10(2)14(20(16,17)18-6)11(3)12-7-8-15(4,5)19-13(9)12;1-2/h7-8H2,1-6H3;1-2H3 |
| InChIKey | WKADIAWAWNTDRA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|