C19H31NO3 — CID 164687688
trimethyl-(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)azanium acetate (PubChem CID 164687688) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is trimethyl-(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)azanium acetate.
| Compound Name | trimethyl-(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)azanium acetate |
|---|---|
| PubChem CID | 164687688 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | trimethyl-(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)azanium acetate |
| SMILES | CC(=O)[O-].Cc1c(C)c([N+](C)(C)C)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C17H28NO.C2H4O2/c1-11-12(2)16-14(9-10-17(4,5)19-16)13(3)15(11)18(6,7)8;1-2(3)4/h9-10H2,1-8H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | RTVRYMOXPBGKOP-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|