C14H19O4+ — CID 163585580
(2-carboxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl)oxidanium (PubChem CID 163585580) has the molecular formula C14H19O4+ and a molecular weight of 251.30 g/mol. Its IUPAC name is (2-carboxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl)oxidanium.
| Compound Name | (2-carboxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl)oxidanium |
|---|---|
| PubChem CID | 163585580 |
| Molecular Formula | C14H19O4+ |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2-carboxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl)oxidanium |
| SMILES | Cc1c(C)c2c(c(C)c1[OH2+])CCC(C)(C(=O)O)O2 |
| InChI | InChI=1S/C14H18O4/c1-7-8(2)12-10(9(3)11(7)15)5-6-14(4,18-12)13(16)17/h15H,5-6H2,1-4H3,(H,16,17)/p+1 |
| InChIKey | GLEVLJDDWXEYCO-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 69.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|