C19H23ClO5 — CID 123519329
6-(4-chloropent-4-enoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 123519329) has the molecular formula C19H23ClO5 and a molecular weight of 366.84 g/mol. Its IUPAC name is 6-(4-chloropent-4-enoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | 6-(4-chloropent-4-enoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 123519329 |
| Molecular Formula | C19H23ClO5 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 6-(4-chloropent-4-enoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | C=C(Cl)CCC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(C(=O)O)O2 |
| InChI | InChI=1S/C19H23ClO5/c1-10(20)6-7-15(21)24-16-11(2)12(3)17-14(13(16)4)8-9-19(5,25-17)18(22)23/h1,6-9H2,2-5H3,(H,22,23) |
| InChIKey | KLHXKKSJVHTKDG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|