C31H43O8+ — CID 158463704
[2-(hydroxymethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate;(4-hydroxy-2,3,6-trimethylphenyl) acetate;2-methylprop-2-en-1-ol (PubChem CID 158463704) has the molecular formula C31H43O8+ and a molecular weight of 543.68 g/mol. Its IUPAC name is [2-(hydroxymethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate;(4-hydroxy-2,3,6-trimethylphenyl) acetate;2-methylprop-2-en-1-ol.
| Compound Name | [2-(hydroxymethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate;(4-hydroxy-2,3,6-trimethylphenyl) acetate;2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 158463704 |
| Molecular Formula | C31H43O8+ |
| Molecular Weight | 543.68 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | [2-(hydroxymethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate;(4-hydroxy-2,3,6-trimethylphenyl) acetate;2-methylprop-2-en-1-ol |
| SMILES | C=C([CH2+])CO.CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CO)O2.CC(=O)Oc1c(C)cc(O)c(C)c1C |
| InChI | InChI=1S/C16H22O4.C11H14O3.C4H7O/c1-9-10(2)15-13(6-7-16(5,8-17)20-15)11(3)14(9)19-12(4)18;1-6-5-10(13)7(2)8(3)11(6)14-9(4)12;1-4(2)3-5/h17H,6-8H2,1-5H3;5,13H,1-4H3;5H,1-3H2/q;;+1 |
| InChIKey | HFMJZVTWEHLXBL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.68 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|