C21H30O4 — CID 101470366
[2-[2-(3,3-dimethyloxiran-2-yl)ethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate (PubChem CID 101470366) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is [2-[2-(3,3-dimethyloxiran-2-yl)ethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2-[2-(3,3-dimethyloxiran-2-yl)ethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 101470366 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [2-[2-(3,3-dimethyloxiran-2-yl)ethyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CCC1OC1(C)C)O2 |
| InChI | InChI=1S/C21H30O4/c1-12-13(2)19-16(14(3)18(12)23-15(4)22)8-10-21(7,25-19)11-9-17-20(5,6)24-17/h17H,8-11H2,1-7H3 |
| InChIKey | JXZMQVAVKRWIIF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|